About 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile
3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile (PubChem CID 10314778) has the molecular formula C19H15N3OS
and a molecular weight of 333.42 g/mol. Its IUPAC name is 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile |
| PubChem CID | 10314778 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile |
| SMILES | CCc1ccccc1C(=O)c1cnc(Nc2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C19H15N3OS/c1-2-14-7-3-4-9-16(14)18(23)17-12-21-19(24-17)22-15-8-5-6-13(10-15)11-20/h3-10,12H,2H2,1H3,(H,21,22) |
| InChIKey | KHEMIBGWHZGRPJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The IUPAC name of 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile (CID 10314778) is 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile.
What is the SMILES notation for 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The canonical SMILES for 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile is CCc1ccccc1C(=O)c1cnc(Nc2cccc(C#N)c2)s1.
What is the InChIKey of 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The InChIKey is KHEMIBGWHZGRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3OS/c1-2-14-7-3-4-9-16(14)18(23)17-12-21-19(24-17)22-15-8-5-6-13(10-15)11-20/h3-10,12H,2H2,1H3,(H,21,22).
What are the key properties of 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile?
3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile has a molecular weight of 333.42 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]benzonitrile is sourced from PubChem (CID 10314778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).