C12H20F2N2O2 — CID 103147827
4-(2,2-difluoroethoxy)-1-(1-propan-2-ylpyrazol-3-yl)butan-2-ol (PubChem CID 103147827) has the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(1-propan-2-ylpyrazol-3-yl)butan-2-ol.
| Compound Name | 4-(2,2-difluoroethoxy)-1-(1-propan-2-ylpyrazol-3-yl)butan-2-ol |
|---|---|
| PubChem CID | 103147827 |
| Molecular Formula | C12H20F2N2O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(1-propan-2-ylpyrazol-3-yl)butan-2-ol |
| SMILES | CC(C)n1ccc(CC(O)CCOCC(F)F)n1 |
| InChI | InChI=1S/C12H20F2N2O2/c1-9(2)16-5-3-10(15-16)7-11(17)4-6-18-8-12(13)14/h3,5,9,11-12,17H,4,6-8H2,1-2H3 |
| InChIKey | OGJPYCMPMRUINH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|