C14H24F3NO2 — CID 103147974
1-(6-oxaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103147974) has the molecular formula C14H24F3NO2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(6-oxaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(6-oxaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103147974 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-(6-oxaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)(F)F)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C14H24F3NO2/c15-14(16,17)10-19-7-4-12(18)11-3-8-20-13(9-11)5-1-2-6-13/h11-12H,1-10,18H2 |
| InChIKey | QACHXHXSLPWHLK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|