C13H21BrF3N3O — CID 103147976
1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103147976) has the molecular formula C13H21BrF3N3O and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103147976 |
| Molecular Formula | C13H21BrF3N3O |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | CCc1nn(CC)c(CC(N)CCOCC(F)(F)F)c1Br |
| InChI | InChI=1S/C13H21BrF3N3O/c1-3-10-12(14)11(20(4-2)19-10)7-9(18)5-6-21-8-13(15,16)17/h9H,3-8,18H2,1-2H3 |
| InChIKey | UKUWUPHKGWHLKB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|