C9H11BrF3NOS — CID 103147979
1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103147979) has the molecular formula C9H11BrF3NOS and a molecular weight of 318.16 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103147979 |
| Molecular Formula | C9H11BrF3NOS |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C9H11BrF3NOS/c10-6-2-4-16-8(6)7(14)1-3-15-5-9(11,12)13/h2,4,7H,1,3,5,14H2 |
| InChIKey | LTPPWRVBPACKRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|