C14H24F3NO3 — CID 103148028
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103148028) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103148028 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)(F)F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H24F3NO3/c15-14(16,17)10-20-5-2-12(18)11-1-6-21-13(9-11)3-7-19-8-4-13/h11-12H,1-10,18H2 |
| InChIKey | BDHXHUOWXDUZHH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|