C14H22F3N3O — CID 103148124
1-(1-cyclopentylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103148124) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(1-cyclopentylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148124 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-(1-cyclopentylpyrazol-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | NC(CCOCC(F)(F)F)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C14H22F3N3O/c15-14(16,17)10-21-8-6-11(18)9-12-5-7-20(19-12)13-3-1-2-4-13/h5,7,11,13H,1-4,6,8-10,18H2 |
| InChIKey | BASNEHXJZDIIMD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|