C14H26F3NO — CID 103148367
1-(3,4-dimethylcyclohexyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103148367) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103148367 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CNC(CCOCC(F)(F)F)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H26F3NO/c1-10-4-5-12(8-11(10)2)13(18-3)6-7-19-9-14(15,16)17/h10-13,18H,4-9H2,1-3H3 |
| InChIKey | OCLDVGJGXIJTFU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|