C14H19FO4S2 — CID 10314837
5-tert-butyl-2-(4-fluorophenyl)-1,3-dithiane 1,1,3,3-tetraoxide (PubChem CID 10314837) has the molecular formula C14H19FO4S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-fluorophenyl)-1,3-dithiane 1,1,3,3-tetraoxide.
| Compound Name | 5-tert-butyl-2-(4-fluorophenyl)-1,3-dithiane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 10314837 |
| Molecular Formula | C14H19FO4S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-tert-butyl-2-(4-fluorophenyl)-1,3-dithiane 1,1,3,3-tetraoxide |
| SMILES | CC(C)(C)C1CS(=O)(=O)C(c2ccc(F)cc2)S(=O)(=O)C1 |
| InChI | InChI=1S/C14H19FO4S2/c1-14(2,3)11-8-20(16,17)13(21(18,19)9-11)10-4-6-12(15)7-5-10/h4-7,11,13H,8-9H2,1-3H3 |
| InChIKey | PMAZLRYYPLBLBN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |