C12H19BrF3N3O — CID 103148461
1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103148461) has the molecular formula C12H19BrF3N3O and a molecular weight of 358.20 g/mol. Its IUPAC name is 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148461 |
| Molecular Formula | C12H19BrF3N3O |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | CNC(CCOCC(F)(F)F)Cc1c(Br)c(C)nn1C |
| InChI | InChI=1S/C12H19BrF3N3O/c1-8-11(13)10(19(3)18-8)6-9(17-2)4-5-20-7-12(14,15)16/h9,17H,4-7H2,1-3H3 |
| InChIKey | MIRIRDBFDMZWQJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|