C15H28F3NO — CID 103148585
1-(3,4-dimethylcyclohexyl)-N-ethyl-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103148585) has the molecular formula C15H28F3NO and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-N-ethyl-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-N-ethyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103148585 |
| Molecular Formula | C15H28F3NO |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-N-ethyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CCNC(CCOCC(F)(F)F)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C15H28F3NO/c1-4-19-14(7-8-20-10-15(16,17)18)13-6-5-11(2)12(3)9-13/h11-14,19H,4-10H2,1-3H3 |
| InChIKey | ULFIUCQEEFYKAG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|