C13H21ClF3N3O — CID 103148632
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103148632) has the molecular formula C13H21ClF3N3O and a molecular weight of 327.78 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148632 |
| Molecular Formula | C13H21ClF3N3O |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | CCNC(CCOCC(F)(F)F)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H21ClF3N3O/c1-4-18-10(5-6-21-8-13(15,16)17)7-11-9(2)19-20(3)12(11)14/h10,18H,4-8H2,1-3H3 |
| InChIKey | LLRLRSUQRBOVDS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|