C10H19F2NO2 — CID 103149014
3-(2,2-difluoroethoxy)-1-(oxan-4-yl)propan-1-amine (PubChem CID 103149014) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(oxan-4-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(oxan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 103149014 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(oxan-4-yl)propan-1-amine |
| SMILES | NC(CCOCC(F)F)C1CCOCC1 |
| InChI | InChI=1S/C10H19F2NO2/c11-10(12)7-15-6-3-9(13)8-1-4-14-5-2-8/h8-10H,1-7,13H2 |
| InChIKey | WHAUVYHREDUPQX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|