C9H17F2NO — CID 103149040
1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 103149040) has the molecular formula C9H17F2NO and a molecular weight of 193.24 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103149040 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-cyclobutyl-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)F)C1CCC1 |
| InChI | InChI=1S/C9H17F2NO/c10-9(11)6-13-5-4-8(12)7-2-1-3-7/h7-9H,1-6,12H2 |
| InChIKey | MVKXJMHTFIIITM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|