C9H17F2NO — CID 103149222
5-(2,2-difluoroethoxy)-N,2-dimethylpent-1-en-3-amine (PubChem CID 103149222) has the molecular formula C9H17F2NO and a molecular weight of 193.24 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-N,2-dimethylpent-1-en-3-amine.
| Compound Name | 5-(2,2-difluoroethoxy)-N,2-dimethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 103149222 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-N,2-dimethylpent-1-en-3-amine |
| SMILES | C=C(C)C(CCOCC(F)F)NC |
| InChI | InChI=1S/C9H17F2NO/c1-7(2)8(12-3)4-5-13-6-9(10)11/h8-9,12H,1,4-6H2,2-3H3 |
| InChIKey | WXXWYNPLYJRNTF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|