About 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine
3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine (PubChem CID 103149273) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine |
| PubChem CID | 103149273 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine |
| SMILES | CNC(CCOCC(F)F)C1=CCCCO1 |
| InChI | InChI=1S/C11H19F2NO2/c1-14-9(5-7-15-8-11(12)13)10-4-2-3-6-16-10/h4,9,11,14H,2-3,5-8H2,1H3 |
| InChIKey | SORWUZIWEBAQHP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine?
The IUPAC name of 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine (CID 103149273) is 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine?
The canonical SMILES for 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine is CNC(CCOCC(F)F)C1=CCCCO1.
What is the InChIKey of 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine?
The InChIKey is SORWUZIWEBAQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-14-9(5-7-15-8-11(12)13)10-4-2-3-6-16-10/h4,9,11,14H,2-3,5-8H2,1H3.
What are the key properties of 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine?
3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine has a molecular weight of 235.27 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)-N-methylpropan-1-amine is sourced from PubChem (CID 103149273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).