About 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine
1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine (PubChem CID 103149459) has the molecular formula C12H25F2NO2
and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine |
| PubChem CID | 103149459 |
| Molecular Formula | C12H25F2NO2 |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine |
| SMILES | CNC(CCOCC(F)F)CCC(C)(C)OC |
| InChI | InChI=1S/C12H25F2NO2/c1-12(2,16-4)7-5-10(15-3)6-8-17-9-11(13)14/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | MMGROQBHZLTEKX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine?
The IUPAC name of 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine (CID 103149459) is 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine.
What is the SMILES notation for 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine?
The canonical SMILES for 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine is CNC(CCOCC(F)F)CCC(C)(C)OC.
What is the InChIKey of 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine?
The InChIKey is MMGROQBHZLTEKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25F2NO2/c1-12(2,16-4)7-5-10(15-3)6-8-17-9-11(13)14/h10-11,15H,5-9H2,1-4H3.
What are the key properties of 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine?
1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine has a molecular weight of 253.33 g/mol, XLogP of 2.45, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethoxy)-6-methoxy-N,6-dimethylheptan-3-amine is sourced from PubChem (CID 103149459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).