About 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine
1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine (PubChem CID 103149501) has the molecular formula C15H26F2N2OS
and a molecular weight of 320.45 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine |
| PubChem CID | 103149501 |
| Molecular Formula | C15H26F2N2OS |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine |
| SMILES | CCNC(CCOCC(F)F)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C15H26F2N2OS/c1-5-18-11(6-7-20-9-13(16)17)8-14-19-12(10-21-14)15(2,3)4/h10-11,13,18H,5-9H2,1-4H3 |
| InChIKey | AHMKADNRWMLHBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine?
The IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine (CID 103149501) is 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine.
What is the SMILES notation for 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine?
The canonical SMILES for 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine is CCNC(CCOCC(F)F)Cc1nc(C(C)(C)C)cs1.
What is the InChIKey of 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine?
The InChIKey is AHMKADNRWMLHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2OS/c1-5-18-11(6-7-20-9-13(16)17)8-14-19-12(10-21-14)15(2,3)4/h10-11,13,18H,5-9H2,1-4H3.
What are the key properties of 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine?
1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine has a molecular weight of 320.45 g/mol, XLogP of 3.63, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2,2-difluoroethoxy)-N-ethylbutan-2-amine is sourced from PubChem (CID 103149501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).