C14H27F2NO3S — CID 103149570
3-(2,2-difluoroethoxy)-N-ethyl-1-(3-methylsulfonylcyclohexyl)propan-1-amine (PubChem CID 103149570) has the molecular formula C14H27F2NO3S and a molecular weight of 327.44 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-ethyl-1-(3-methylsulfonylcyclohexyl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(3-methylsulfonylcyclohexyl)propan-1-amine |
|---|---|
| PubChem CID | 103149570 |
| Molecular Formula | C14H27F2NO3S |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(3-methylsulfonylcyclohexyl)propan-1-amine |
| SMILES | CCNC(CCOCC(F)F)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H27F2NO3S/c1-3-17-13(7-8-20-10-14(15)16)11-5-4-6-12(9-11)21(2,18)19/h11-14,17H,3-10H2,1-2H3 |
| InChIKey | ACUOQJGAKMBCSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|