C13H23F2N3O — CID 103149610
1-(2,2-difluoroethoxy)-N-ethyl-5-(2-methylpyrazol-3-yl)pentan-3-amine (PubChem CID 103149610) has the molecular formula C13H23F2N3O and a molecular weight of 275.34 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-N-ethyl-5-(2-methylpyrazol-3-yl)pentan-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-N-ethyl-5-(2-methylpyrazol-3-yl)pentan-3-amine |
|---|---|
| PubChem CID | 103149610 |
| Molecular Formula | C13H23F2N3O |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-N-ethyl-5-(2-methylpyrazol-3-yl)pentan-3-amine |
| SMILES | CCNC(CCOCC(F)F)CCc1ccnn1C |
| InChI | InChI=1S/C13H23F2N3O/c1-3-16-11(7-9-19-10-13(14)15)4-5-12-6-8-17-18(12)2/h6,8,11,13,16H,3-5,7,9-10H2,1-2H3 |
| InChIKey | MBDGAKHWEOWGAI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|