C15H27F2NO2S — CID 103149776
3-(2,2-difluoroethoxy)-N-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-amine (PubChem CID 103149776) has the molecular formula C15H27F2NO2S and a molecular weight of 323.45 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 103149776 |
| Molecular Formula | C15H27F2NO2S |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-amine |
| SMILES | CCNC(CCOCC(F)F)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H27F2NO2S/c1-2-18-13(4-6-19-10-14(16)17)12-3-7-20-15(9-12)5-8-21-11-15/h12-14,18H,2-11H2,1H3 |
| InChIKey | XYSACKCVBCBIBK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|