About 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine
1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine (PubChem CID 103149937) has the molecular formula C13H25F2NO
and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine.
Molecular Properties
| Compound Name | 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine |
| PubChem CID | 103149937 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOCC(F)F)CC1CCC1 |
| InChI | InChI=1S/C13H25F2NO/c1-2-7-16-12(9-11-4-3-5-11)6-8-17-10-13(14)15/h11-13,16H,2-10H2,1H3 |
| InChIKey | NTUZKNPWFGFWLI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine?
The IUPAC name of 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine (CID 103149937) is 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine.
What is the SMILES notation for 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine?
The canonical SMILES for 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine is CCCNC(CCOCC(F)F)CC1CCC1.
What is the InChIKey of 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine?
The InChIKey is NTUZKNPWFGFWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F2NO/c1-2-7-16-12(9-11-4-3-5-11)6-8-17-10-13(14)15/h11-13,16H,2-10H2,1H3.
What are the key properties of 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine?
1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine has a molecular weight of 249.34 g/mol, XLogP of 3.22, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-4-(2,2-difluoroethoxy)-N-propylbutan-2-amine is sourced from PubChem (CID 103149937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).