C16H25F2NO2 — CID 103150052
4-(2,2-difluoroethoxy)-1-(2-methoxyphenyl)-N-propylbutan-2-amine (PubChem CID 103150052) has the molecular formula C16H25F2NO2 and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(2-methoxyphenyl)-N-propylbutan-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-1-(2-methoxyphenyl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 103150052 |
| Molecular Formula | C16H25F2NO2 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(2-methoxyphenyl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOCC(F)F)Cc1ccccc1OC |
| InChI | InChI=1S/C16H25F2NO2/c1-3-9-19-14(8-10-21-12-16(17)18)11-13-6-4-5-7-15(13)20-2/h4-7,14,16,19H,3,8-12H2,1-2H3 |
| InChIKey | ASNBGAFFHPKQHH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|