C13H20F2N2OS — CID 103150118
2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 103150118) has the molecular formula C13H20F2N2OS and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 103150118 |
| Molecular Formula | C13H20F2N2OS |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CCNC1CCCc2nc(CCOCC(F)F)sc21 |
| InChI | InChI=1S/C13H20F2N2OS/c1-2-16-9-4-3-5-10-13(9)19-12(17-10)6-7-18-8-11(14)15/h9,11,16H,2-8H2,1H3 |
| InChIKey | ZKJNITUJKAAFBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|