C14H21F3N2OS — CID 103150121
N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 103150121) has the molecular formula C14H21F3N2OS and a molecular weight of 322.40 g/mol. Its IUPAC name is N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 103150121 |
| Molecular Formula | C14H21F3N2OS |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CCCNC1CCCc2nc(CCOCC(F)(F)F)sc21 |
| InChI | InChI=1S/C14H21F3N2OS/c1-2-7-18-10-4-3-5-11-13(10)21-12(19-11)6-8-20-9-14(15,16)17/h10,18H,2-9H2,1H3 |
| InChIKey | VBUKHGSXHVPNTO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|