C11H15F3N2OS — CID 103150142
2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 103150142) has the molecular formula C11H15F3N2OS and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 103150142 |
| Molecular Formula | C11H15F3N2OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | NC1CCCc2sc(CCOCC(F)(F)F)nc21 |
| InChI | InChI=1S/C11H15F3N2OS/c12-11(13,14)6-17-5-4-9-16-10-7(15)2-1-3-8(10)18-9/h7H,1-6,15H2 |
| InChIKey | VVXFABWBQGMVNK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|