About 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine
2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine (PubChem CID 103150273) has the molecular formula C11H17F2N3O
and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine |
| PubChem CID | 103150273 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(N)nc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C11H17F2N3O/c1-7(2)8-5-10(14)16-11(15-8)3-4-17-6-9(12)13/h5,7,9H,3-4,6H2,1-2H3,(H2,14,15,16) |
| InChIKey | ZFMOBEWRUUDARC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine (CID 103150273) is 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine is CC(C)c1cc(N)nc(CCOCC(F)F)n1.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine?
The InChIKey is ZFMOBEWRUUDARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O/c1-7(2)8-5-10(14)16-11(15-8)3-4-17-6-9(12)13/h5,7,9H,3-4,6H2,1-2H3,(H2,14,15,16).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine?
2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine has a molecular weight of 245.27 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-6-propan-2-ylpyrimidin-4-amine is sourced from PubChem (CID 103150273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).