C14H20F3N3O — CID 103150319
N-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 103150319) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is N-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 103150319 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CCNc1nc(CCOCC(F)(F)F)nc2c1CCCC2 |
| InChI | InChI=1S/C14H20F3N3O/c1-2-18-13-10-5-3-4-6-11(10)19-12(20-13)7-8-21-9-14(15,16)17/h2-9H2,1H3,(H,18,19,20) |
| InChIKey | DPGUEINEOGONFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|