C15H23F2N3O — CID 103150320
2-[2-(2,2-difluoroethoxy)ethyl]-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 103150320) has the molecular formula C15H23F2N3O and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 103150320 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CCCNc1nc(CCOCC(F)F)nc2c1CCCC2 |
| InChI | InChI=1S/C15H23F2N3O/c1-2-8-18-15-11-5-3-4-6-12(11)19-14(20-15)7-9-21-10-13(16)17/h13H,2-10H2,1H3,(H,18,19,20) |
| InChIKey | KRFCZRAJTKNOJL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|