C12H17BrF3N3O — CID 103150376
5-bromo-6-methyl-N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 103150376) has the molecular formula C12H17BrF3N3O and a molecular weight of 356.19 g/mol. Its IUPAC name is 5-bromo-6-methyl-N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 5-bromo-6-methyl-N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103150376 |
| Molecular Formula | C12H17BrF3N3O |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 5-bromo-6-methyl-N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | CCCNc1nc(CCOCC(F)(F)F)nc(C)c1Br |
| InChI | InChI=1S/C12H17BrF3N3O/c1-3-5-17-11-10(13)8(2)18-9(19-11)4-6-20-7-12(14,15)16/h3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | XGQWBJKYPAHQQD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|