C12H18F2N4O — CID 103150525
[2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine (PubChem CID 103150525) has the molecular formula C12H18F2N4O and a molecular weight of 272.30 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine.
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 103150525 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
| SMILES | NNc1nc(CCOCC(F)F)nc2c1CCCC2 |
| InChI | InChI=1S/C12H18F2N4O/c13-10(14)7-19-6-5-11-16-9-4-2-1-3-8(9)12(17-11)18-15/h10H,1-7,15H2,(H,16,17,18) |
| InChIKey | FIYLPWPDDSCJQD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|