About [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine
[2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 103150532) has the molecular formula C12H20F2N4O
and a molecular weight of 274.31 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| PubChem CID | 103150532 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CCOCC(F)F)nc(NN)c1C(C)C |
| InChI | InChI=1S/C12H20F2N4O/c1-7(2)11-8(3)16-10(17-12(11)18-15)4-5-19-6-9(13)14/h7,9H,4-6,15H2,1-3H3,(H,16,17,18) |
| InChIKey | FPDNOOXJAJVXBW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine (CID 103150532) is [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine is Cc1nc(CCOCC(F)F)nc(NN)c1C(C)C.
What is the InChIKey of [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine?
The InChIKey is FPDNOOXJAJVXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N4O/c1-7(2)11-8(3)16-10(17-12(11)18-15)4-5-19-6-9(13)14/h7,9H,4-6,15H2,1-3H3,(H,16,17,18).
What are the key properties of [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine?
[2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine has a molecular weight of 274.31 g/mol, XLogP of 2.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 103150532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).