C8H10F2N2O3 — CID 103150548
2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazole-5-carboxylic acid (PubChem CID 103150548) has the molecular formula C8H10F2N2O3 and a molecular weight of 220.17 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazole-5-carboxylic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103150548 |
| Molecular Formula | C8H10F2N2O3 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(CCOCC(F)F)[nH]1 |
| InChI | InChI=1S/C8H10F2N2O3/c9-6(10)4-15-2-1-7-11-3-5(12-7)8(13)14/h3,6H,1-2,4H2,(H,11,12)(H,13,14) |
| InChIKey | ADIDGXCFPFEEKV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|