C10H15F3N2O2S — CID 103150603
[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine (PubChem CID 103150603) has the molecular formula C10H15F3N2O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is [4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103150603 |
| Molecular Formula | C10H15F3N2O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine |
| SMILES | COCc1nc(CCOCC(F)(F)F)sc1CN |
| InChI | InChI=1S/C10H15F3N2O2S/c1-16-5-7-8(4-14)18-9(15-7)2-3-17-6-10(11,12)13/h2-6,14H2,1H3 |
| InChIKey | DWKHLERFCLRDFQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|