C11H17F3N2O2S — CID 103150634
1-[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 103150634) has the molecular formula C11H17F3N2O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103150634 |
| Molecular Formula | C11H17F3N2O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1sc(CCOCC(F)(F)F)nc1COC |
| InChI | InChI=1S/C11H17F3N2O2S/c1-15-5-9-8(6-17-2)16-10(19-9)3-4-18-7-11(12,13)14/h15H,3-7H2,1-2H3 |
| InChIKey | JFCPSIUNASRBIY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|