C12H19F3N2O2S — CID 103150636
N-[[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 103150636) has the molecular formula C12H19F3N2O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103150636 |
| Molecular Formula | C12H19F3N2O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[[4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(CCOCC(F)(F)F)nc1COC |
| InChI | InChI=1S/C12H19F3N2O2S/c1-3-16-6-10-9(7-18-2)17-11(20-10)4-5-19-8-12(13,14)15/h16H,3-8H2,1-2H3 |
| InChIKey | ZZTPJTPLAVCHAL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|