C20H22F4 — CID 10315074
1,2,4,5-tetrafluoro-3,6-bis(hept-1-ynyl)benzene (PubChem CID 10315074) has the molecular formula C20H22F4 and a molecular weight of 338.39 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(hept-1-ynyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(hept-1-ynyl)benzene |
|---|---|
| PubChem CID | 10315074 |
| Molecular Formula | C20H22F4 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(hept-1-ynyl)benzene |
| SMILES | CCCCCC#Cc1c(F)c(F)c(C#CCCCCC)c(F)c1F |
| InChI | InChI=1S/C20H22F4/c1-3-5-7-9-11-13-15-17(21)19(23)16(20(24)18(15)22)14-12-10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | CWWUWCSCHIQBER-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|