C7H11F3N4O — CID 103150842
[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 103150842) has the molecular formula C7H11F3N4O and a molecular weight of 224.19 g/mol. Its IUPAC name is [3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103150842 |
| Molecular Formula | C7H11F3N4O |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | NCc1nc(CCOCC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H11F3N4O/c8-7(9,10)4-15-2-1-5-12-6(3-11)14-13-5/h1-4,11H2,(H,12,13,14) |
| InChIKey | HZVIJKCYHJSZTB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|