C8H14F2N4O — CID 103150843
1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]ethanamine (PubChem CID 103150843) has the molecular formula C8H14F2N4O and a molecular weight of 220.22 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 103150843 |
| Molecular Formula | C8H14F2N4O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]ethanamine |
| SMILES | CC(N)c1n[nH]c(CCOCC(F)F)n1 |
| InChI | InChI=1S/C8H14F2N4O/c1-5(11)8-12-7(13-14-8)2-3-15-4-6(9)10/h5-6H,2-4,11H2,1H3,(H,12,13,14) |
| InChIKey | BPWRWPANIDXZRC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|