C11H18F3N3O2 — CID 103150873
2-methoxy-N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]ethanamine (PubChem CID 103150873) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-methoxy-N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103150873 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-methoxy-N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1cnc(CCOCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H18F3N3O2/c1-18-5-3-15-6-9-7-16-10(17-9)2-4-19-8-11(12,13)14/h7,15H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | LQSOALHDVZKILK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|