C12H17F3N2O3 — CID 103150918
4-methyl-1-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pentan-2-one (PubChem CID 103150918) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-methyl-1-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pentan-2-one.
| Compound Name | 4-methyl-1-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pentan-2-one |
|---|---|
| PubChem CID | 103150918 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-methyl-1-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pentan-2-one |
| SMILES | CC(C)CC(=O)Cc1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C12H17F3N2O3/c1-8(2)5-9(18)6-11-16-10(17-20-11)3-4-19-7-12(13,14)15/h8H,3-7H2,1-2H3 |
| InChIKey | IIYDZNPDABGUFJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|