C12H18F2N2O3 — CID 103150938
1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-4-methylpentan-2-one (PubChem CID 103150938) has the molecular formula C12H18F2N2O3 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-4-methylpentan-2-one.
| Compound Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 103150938 |
| Molecular Formula | C12H18F2N2O3 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)Cc1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C12H18F2N2O3/c1-8(2)5-9(17)6-12-15-11(16-19-12)3-4-18-7-10(13)14/h8,10H,3-7H2,1-2H3 |
| InChIKey | VOWZKJQXJRPBQV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|