C10H14F2N2O3 — CID 103150940
3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 103150940) has the molecular formula C10H14F2N2O3 and a molecular weight of 248.23 g/mol. Its IUPAC name is 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 103150940 |
| Molecular Formula | C10H14F2N2O3 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CC(=O)C(C)c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C10H14F2N2O3/c1-6(7(2)15)10-13-9(14-17-10)3-4-16-5-8(11)12/h6,8H,3-5H2,1-2H3 |
| InChIKey | ATZODBLFVWEETO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|