C11H14F2N2O3 — CID 103150946
1-cyclopropyl-2-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanone (PubChem CID 103150946) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 103150946 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-cyclopropyl-2-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanone |
| SMILES | O=C(Cc1nc(CCOCC(F)F)no1)C1CC1 |
| InChI | InChI=1S/C11H14F2N2O3/c12-9(13)6-17-4-3-10-14-11(18-15-10)5-8(16)7-1-2-7/h7,9H,1-6H2 |
| InChIKey | RTPWCNTZOPGWGL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|