C14H25F2N3O2 — CID 103151040
1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-propylpentan-2-amine (PubChem CID 103151040) has the molecular formula C14H25F2N3O2 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-propylpentan-2-amine.
| Compound Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 103151040 |
| Molecular Formula | C14H25F2N3O2 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC)Cc1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C14H25F2N3O2/c1-3-5-11(17-7-4-2)9-14-18-13(19-21-14)6-8-20-10-12(15)16/h11-12,17H,3-10H2,1-2H3 |
| InChIKey | VZMVNJFVLDNXCA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|