C12H21F2N3O2 — CID 103151060
1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylbutan-2-amine (PubChem CID 103151060) has the molecular formula C12H21F2N3O2 and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylbutan-2-amine.
| Compound Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylbutan-2-amine |
|---|---|
| PubChem CID | 103151060 |
| Molecular Formula | C12H21F2N3O2 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylbutan-2-amine |
| SMILES | CCNC(CC)Cc1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C12H21F2N3O2/c1-3-9(15-4-2)7-12-16-11(17-19-12)5-6-18-8-10(13)14/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | YPWQDMWDLUMCEA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|