C13H23F2N3O2 — CID 103151069
1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylpentan-2-amine (PubChem CID 103151069) has the molecular formula C13H23F2N3O2 and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylpentan-2-amine.
| Compound Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylpentan-2-amine |
|---|---|
| PubChem CID | 103151069 |
| Molecular Formula | C13H23F2N3O2 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N-ethylpentan-2-amine |
| SMILES | CCCC(Cc1nc(CCOCC(F)F)no1)NCC |
| InChI | InChI=1S/C13H23F2N3O2/c1-3-5-10(16-4-2)8-13-17-12(18-20-13)6-7-19-9-11(14)15/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | BEGNAEZZCKYFOR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|