C8H12F2N2O3 — CID 103151136
(1S)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 103151136) has the molecular formula C8H12F2N2O3 and a molecular weight of 222.19 g/mol. Its IUPAC name is (1S)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (1S)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 103151136 |
| Molecular Formula | C8H12F2N2O3 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1S)-1-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | C[C@H](O)c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C8H12F2N2O3/c1-5(13)8-11-7(12-15-8)2-3-14-4-6(9)10/h5-6,13H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | CHMCNYMBGVMNRB-YFKPBYRVSA-N |
| XLogP | 0.95 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|