C6H7ClF3N3O — CID 103151176
3-chloro-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole (PubChem CID 103151176) has the molecular formula C6H7ClF3N3O and a molecular weight of 229.59 g/mol. Its IUPAC name is 3-chloro-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole.
| Compound Name | 3-chloro-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 103151176 |
| Molecular Formula | C6H7ClF3N3O |
| Molecular Weight | 229.59 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 3-chloro-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole |
| SMILES | FC(F)(F)COCCc1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C6H7ClF3N3O/c7-5-11-4(12-13-5)1-2-14-3-6(8,9)10/h1-3H2,(H,11,12,13) |
| InChIKey | HEBDOLJCPMSMPJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|