C8H13F2N3OS — CID 103151216
3-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-1,2,4-thiadiazol-5-amine (PubChem CID 103151216) has the molecular formula C8H13F2N3OS and a molecular weight of 237.27 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103151216 |
| Molecular Formula | C8H13F2N3OS |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-ethyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCNc1nc(CCOCC(F)F)ns1 |
| InChI | InChI=1S/C8H13F2N3OS/c1-2-11-8-12-7(13-15-8)3-4-14-5-6(9)10/h6H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | VLSZKNMCMQCMGU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|